C12H22FN3 — CID 177357033
N-[(1Z,3Z)-3-(1-amino-1-fluoroethyl)hepta-1,3-dienyl]-N'-methylethanimidamide (PubChem CID 177357033) has the molecular formula C12H22FN3 and a molecular weight of 227.33 g/mol. Its IUPAC name is N-[(1Z,3Z)-3-(1-amino-1-fluoroethyl)hepta-1,3-dienyl]-N'-methylethanimidamide.
| Compound Name | N-[(1Z,3Z)-3-(1-amino-1-fluoroethyl)hepta-1,3-dienyl]-N'-methylethanimidamide |
|---|---|
| PubChem CID | 177357033 |
| Molecular Formula | C12H22FN3 |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.18 |
| IUPAC Name | N-[(1Z,3Z)-3-(1-amino-1-fluoroethyl)hepta-1,3-dienyl]-N'-methylethanimidamide |
| SMILES | CCC/C=C(/C=C\N/C(C)=N/C)C(C)(N)F |
| InChI | InChI=1S/C12H22FN3/c1-5-6-7-11(12(3,13)14)8-9-16-10(2)15-4/h7-9H,5-6,14H2,1-4H3,(H,15,16)/b9-8-,11-7- |
| InChIKey | RVXGANLFACWJPY-VVPOTFPNSA-N |
| XLogP | 2.51 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|