C20H27N3O — CID 109161803
N-(2,3-dimethylphenyl)-6-(dipropylamino)pyridine-3-carboxamide (PubChem CID 109161803) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-6-(dipropylamino)pyridine-3-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-6-(dipropylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109161803 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | N-(2,3-dimethylphenyl)-6-(dipropylamino)pyridine-3-carboxamide |
| SMILES | CCCN(CCC)c1ccc(C(=O)Nc2cccc(C)c2C)cn1 |
| InChI | InChI=1S/C20H27N3O/c1-5-12-23(13-6-2)19-11-10-17(14-21-19)20(24)22-18-9-7-8-15(3)16(18)4/h7-11,14H,5-6,12-13H2,1-4H3,(H,22,24) |
| InChIKey | VOSQTXSYCXJQDS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |