C20H20N4O — CID 110178439
N-(2,3-dimethylphenyl)-6-(2-phenylhydrazinyl)pyridine-3-carboxamide (PubChem CID 110178439) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-6-(2-phenylhydrazinyl)pyridine-3-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-6-(2-phenylhydrazinyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110178439 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N-(2,3-dimethylphenyl)-6-(2-phenylhydrazinyl)pyridine-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2ccc(NNc3ccccc3)nc2)c1C |
| InChI | InChI=1S/C20H20N4O/c1-14-7-6-10-18(15(14)2)22-20(25)16-11-12-19(21-13-16)24-23-17-8-4-3-5-9-17/h3-13,23H,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | QSEOZGFYHAMPKP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|