C20H17ClFN3O — CID 109161942
6-[2-(3-chlorophenyl)ethylamino]-N-(2-fluorophenyl)pyridine-3-carboxamide (PubChem CID 109161942) has the molecular formula C20H17ClFN3O and a molecular weight of 369.83 g/mol. Its IUPAC name is 6-[2-(3-chlorophenyl)ethylamino]-N-(2-fluorophenyl)pyridine-3-carboxamide.
| Compound Name | 6-[2-(3-chlorophenyl)ethylamino]-N-(2-fluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109161942 |
| Molecular Formula | C20H17ClFN3O |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 6-[2-(3-chlorophenyl)ethylamino]-N-(2-fluorophenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1F)c1ccc(NCCc2cccc(Cl)c2)nc1 |
| InChI | InChI=1S/C20H17ClFN3O/c21-16-5-3-4-14(12-16)10-11-23-19-9-8-15(13-24-19)20(26)25-18-7-2-1-6-17(18)22/h1-9,12-13H,10-11H2,(H,23,24)(H,25,26) |
| InChIKey | ARTGLTNOLNUECX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |