C21H20ClN3O — CID 109158236
N-(3-chloro-2-methylphenyl)-6-(2-phenylethylamino)pyridine-3-carboxamide (PubChem CID 109158236) has the molecular formula C21H20ClN3O and a molecular weight of 365.86 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-6-(2-phenylethylamino)pyridine-3-carboxamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-6-(2-phenylethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109158236 |
| Molecular Formula | C21H20ClN3O |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-6-(2-phenylethylamino)pyridine-3-carboxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)c1ccc(NCCc2ccccc2)nc1 |
| InChI | InChI=1S/C21H20ClN3O/c1-15-18(22)8-5-9-19(15)25-21(26)17-10-11-20(24-14-17)23-13-12-16-6-3-2-4-7-16/h2-11,14H,12-13H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | XBCAZRGYYILWLR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |