C15H15ClFN3O — CID 62166291
N-(3-chloro-2-fluorophenyl)-6-(propylamino)pyridine-3-carboxamide (PubChem CID 62166291) has the molecular formula C15H15ClFN3O and a molecular weight of 307.76 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)-6-(propylamino)pyridine-3-carboxamide.
| Compound Name | N-(3-chloro-2-fluorophenyl)-6-(propylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62166291 |
| Molecular Formula | C15H15ClFN3O |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)-6-(propylamino)pyridine-3-carboxamide |
| SMILES | CCCNc1ccc(C(=O)Nc2cccc(Cl)c2F)cn1 |
| InChI | InChI=1S/C15H15ClFN3O/c1-2-8-18-13-7-6-10(9-19-13)15(21)20-12-5-3-4-11(16)14(12)17/h3-7,9H,2,8H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | WZPMPILEFQHAIR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |