C22H29N3O — CID 109166421
[2-[benzyl(propan-2-yl)amino]-4-pyridinyl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 109166421) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is [2-[benzyl(propan-2-yl)amino]-4-pyridinyl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [2-[benzyl(propan-2-yl)amino]-4-pyridinyl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 109166421 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | [2-[benzyl(propan-2-yl)amino]-4-pyridinyl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2ccnc(N(Cc3ccccc3)C(C)C)c2)CC1 |
| InChI | InChI=1S/C22H29N3O/c1-17(2)25(16-19-7-5-4-6-8-19)21-15-20(9-12-23-21)22(26)24-13-10-18(3)11-14-24/h4-9,12,15,17-18H,10-11,13-14,16H2,1-3H3 |
| InChIKey | LGORGZPAABAHQX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |