C24H25N3O2 — CID 109166454
(4-methylpiperidin-1-yl)-[2-(4-phenoxyanilino)-4-pyridinyl]methanone (PubChem CID 109166454) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-[2-(4-phenoxyanilino)-4-pyridinyl]methanone.
| Compound Name | (4-methylpiperidin-1-yl)-[2-(4-phenoxyanilino)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 109166454 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | (4-methylpiperidin-1-yl)-[2-(4-phenoxyanilino)-4-pyridinyl]methanone |
| SMILES | CC1CCN(C(=O)c2ccnc(Nc3ccc(Oc4ccccc4)cc3)c2)CC1 |
| InChI | InChI=1S/C24H25N3O2/c1-18-12-15-27(16-13-18)24(28)19-11-14-25-23(17-19)26-20-7-9-22(10-8-20)29-21-5-3-2-4-6-21/h2-11,14,17-18H,12-13,15-16H2,1H3,(H,25,26) |
| InChIKey | ZWMXPLWDSKGTTA-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |