C22H27N3O3 — CID 109166621
N-[2-(cyclohexen-1-yl)ethyl]-2-(3,4-dimethoxyanilino)pyridine-4-carboxamide (PubChem CID 109166621) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(3,4-dimethoxyanilino)pyridine-4-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(3,4-dimethoxyanilino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109166621 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(3,4-dimethoxyanilino)pyridine-4-carboxamide |
| SMILES | COc1ccc(Nc2cc(C(=O)NCCC3=CCCCC3)ccn2)cc1OC |
| InChI | InChI=1S/C22H27N3O3/c1-27-19-9-8-18(15-20(19)28-2)25-21-14-17(11-13-23-21)22(26)24-12-10-16-6-4-3-5-7-16/h6,8-9,11,13-15H,3-5,7,10,12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | NJWCUUXSOLYSJD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|