C22H22FN3O3 — CID 109173792
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-fluoroanilino)pyridine-4-carboxamide (PubChem CID 109173792) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-fluoroanilino)pyridine-4-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-fluoroanilino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109173792 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-fluoroanilino)pyridine-4-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2ccnc(Nc3ccc(F)cc3)c2)cc1OC |
| InChI | InChI=1S/C22H22FN3O3/c1-28-19-8-3-15(13-20(19)29-2)9-11-25-22(27)16-10-12-24-21(14-16)26-18-6-4-17(23)5-7-18/h3-8,10,12-14H,9,11H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | ITWNJQYBOQWOPV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |