C18H24N4O4S — CID 109167185
2-(3-methoxypropylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-4-carboxamide (PubChem CID 109167185) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is 2-(3-methoxypropylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-4-carboxamide.
| Compound Name | 2-(3-methoxypropylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109167185 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-(3-methoxypropylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-4-carboxamide |
| SMILES | COCCCNc1cc(C(=O)NCCc2ccc(S(N)(=O)=O)cc2)ccn1 |
| InChI | InChI=1S/C18H24N4O4S/c1-26-12-2-9-20-17-13-15(8-11-21-17)18(23)22-10-7-14-3-5-16(6-4-14)27(19,24)25/h3-6,8,11,13H,2,7,9-10,12H2,1H3,(H,20,21)(H,22,23)(H2,19,24,25) |
| InChIKey | ZMUUCXWWZUPFKZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|