C17H24N4O4S — CID 109168844
4-[2-[(1,1-dioxothiolan-3-yl)-ethylamino]pyridine-4-carbonyl]piperazine-1-carbaldehyde (PubChem CID 109168844) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is 4-[2-[(1,1-dioxothiolan-3-yl)-ethylamino]pyridine-4-carbonyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[2-[(1,1-dioxothiolan-3-yl)-ethylamino]pyridine-4-carbonyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 109168844 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4-[2-[(1,1-dioxothiolan-3-yl)-ethylamino]pyridine-4-carbonyl]piperazine-1-carbaldehyde |
| SMILES | CCN(c1cc(C(=O)N2CCN(C=O)CC2)ccn1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H24N4O4S/c1-2-21(15-4-10-26(24,25)12-15)16-11-14(3-5-18-16)17(23)20-8-6-19(13-22)7-9-20/h3,5,11,13,15H,2,4,6-10,12H2,1H3 |
| InChIKey | WXQMCVJSBAGWLB-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 90.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|