C14H22N6O3S — CID 112946520
4-[3-[(1,1-dioxothiolan-3-yl)-ethylamino]-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde (PubChem CID 112946520) has the molecular formula C14H22N6O3S and a molecular weight of 354.44 g/mol. Its IUPAC name is 4-[3-[(1,1-dioxothiolan-3-yl)-ethylamino]-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[3-[(1,1-dioxothiolan-3-yl)-ethylamino]-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112946520 |
| Molecular Formula | C14H22N6O3S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 4-[3-[(1,1-dioxothiolan-3-yl)-ethylamino]-1,2,4-triazin-5-yl]piperazine-1-carbaldehyde |
| SMILES | CCN(c1nncc(N2CCN(C=O)CC2)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H22N6O3S/c1-2-20(12-3-8-24(22,23)10-12)14-16-13(9-15-17-14)19-6-4-18(11-21)5-7-19/h9,11-12H,2-8,10H2,1H3 |
| InChIKey | VGJUBRWWNXMLOT-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 99.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|