C27H38O4 — CID 10916914
methyl (1S,4aR,4bR,7S,8aR,10aR)-4b,8,8,10a-tetramethyl-2-oxo-7-phenylmethoxy-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1-carboxylate (PubChem CID 10916914) has the molecular formula C27H38O4 and a molecular weight of 426.60 g/mol. Its IUPAC name is methyl (1S,4aR,4bR,7S,8aR,10aR)-4b,8,8,10a-tetramethyl-2-oxo-7-phenylmethoxy-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1S,4aR,4bR,7S,8aR,10aR)-4b,8,8,10a-tetramethyl-2-oxo-7-phenylmethoxy-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 10916914 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | methyl (1S,4aR,4bR,7S,8aR,10aR)-4b,8,8,10a-tetramethyl-2-oxo-7-phenylmethoxy-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)CC[C@H]2[C@@]1(C)CC[C@H]1C(C)(C)[C@@H](OCc3ccccc3)CC[C@]21C |
| InChI | InChI=1S/C27H38O4/c1-25(2)20-13-15-27(4)21(12-11-19(28)23(27)24(29)30-5)26(20,3)16-14-22(25)31-17-18-9-7-6-8-10-18/h6-10,20-23H,11-17H2,1-5H3/t20-,21+,22-,23-,26-,27+/m0/s1 |
| InChIKey | WYZADGYCVIZKKP-ARCLGPMYSA-N |
| XLogP | 5.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|