C37H56O5 — CID 138966411
(1S,2S,5R,7R,10R,13S,14S)-13-[(2R)-4-(3,3-dimethyloxiran-2-yl)butan-2-yl]-14-hydroxy-2,6,6,10,13-pentamethyl-5-phenylmethoxytricyclo[8.6.1.02,7]heptadecane-15,17-dione (PubChem CID 138966411) has the molecular formula C37H56O5 and a molecular weight of 580.85 g/mol. Its IUPAC name is (1S,2S,5R,7R,10R,13S,14S)-13-[(2R)-4-(3,3-dimethyloxiran-2-yl)butan-2-yl]-14-hydroxy-2,6,6,10,13-pentamethyl-5-phenylmethoxytricyclo[8.6.1.02,7]heptadecane-15,17-dione.
| Compound Name | (1S,2S,5R,7R,10R,13S,14S)-13-[(2R)-4-(3,3-dimethyloxiran-2-yl)butan-2-yl]-14-hydroxy-2,6,6,10,13-pentamethyl-5-phenylmethoxytricyclo[8.6.1.02,7]heptadecane-15,17-dione |
|---|---|
| PubChem CID | 138966411 |
| Molecular Formula | C37H56O5 |
| Molecular Weight | 580.85 g/mol |
| Exact Mass | 580.41 |
| IUPAC Name | (1S,2S,5R,7R,10R,13S,14S)-13-[(2R)-4-(3,3-dimethyloxiran-2-yl)butan-2-yl]-14-hydroxy-2,6,6,10,13-pentamethyl-5-phenylmethoxytricyclo[8.6.1.02,7]heptadecane-15,17-dione |
| SMILES | C[C@H](CCC1OC1(C)C)[C@]1(C)CC[C@@]2(C)CC[C@H]3C(C)(C)[C@H](OCc4ccccc4)CC[C@]3(C)[C@H](CC(=O)[C@H]1O)C2=O |
| InChI | InChI=1S/C37H56O5/c1-24(14-15-30-34(4,5)42-30)36(7)21-20-35(6)18-16-28-33(2,3)29(41-23-25-12-10-9-11-13-25)17-19-37(28,8)26(31(35)39)22-27(38)32(36)40/h9-13,24,26,28-30,32,40H,14-23H2,1-8H3/t24-,26-,28+,29-,30?,32-,35-,36+,37-/m1/s1 |
| InChIKey | OTUNTNWYDHDAFU-GPMJODRUSA-N |
| XLogP | 7.71 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.85 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|