C26H42O4Si — CID 11070335
(4aS,6R,8aS)-2-methoxy-1-[methoxy(trimethylsilyl)methyl]-5,5,8a-trimethyl-6-phenylmethoxy-4a,6,7,8-tetrahydro-4H-naphthalen-1-ol (PubChem CID 11070335) has the molecular formula C26H42O4Si and a molecular weight of 446.70 g/mol. Its IUPAC name is (4aS,6R,8aS)-2-methoxy-1-[methoxy(trimethylsilyl)methyl]-5,5,8a-trimethyl-6-phenylmethoxy-4a,6,7,8-tetrahydro-4H-naphthalen-1-ol.
| Compound Name | (4aS,6R,8aS)-2-methoxy-1-[methoxy(trimethylsilyl)methyl]-5,5,8a-trimethyl-6-phenylmethoxy-4a,6,7,8-tetrahydro-4H-naphthalen-1-ol |
|---|---|
| PubChem CID | 11070335 |
| Molecular Formula | C26H42O4Si |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | (4aS,6R,8aS)-2-methoxy-1-[methoxy(trimethylsilyl)methyl]-5,5,8a-trimethyl-6-phenylmethoxy-4a,6,7,8-tetrahydro-4H-naphthalen-1-ol |
| SMILES | COC1=CC[C@H]2C(C)(C)[C@H](OCc3ccccc3)CC[C@]2(C)C1(O)C(OC)[Si](C)(C)C |
| InChI | InChI=1S/C26H42O4Si/c1-24(2)20-14-15-22(28-4)26(27,23(29-5)31(6,7)8)25(20,3)17-16-21(24)30-18-19-12-10-9-11-13-19/h9-13,15,20-21,23,27H,14,16-18H2,1-8H3/t20-,21+,23?,25-,26?/m0/s1 |
| InChIKey | SAJPOMPUPRCRGR-WJXYSSOWSA-N |
| XLogP | 5.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|