C43H60O3 — CID 21136263
(3S,4S,6aR,6bS,8aR,9R,12aR,14aR,14bR)-4,6a,6b,8a,11,11,14b-heptamethyl-3,9-bis(phenylmethoxy)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-4-ol (PubChem CID 21136263) has the molecular formula C43H60O3 and a molecular weight of 624.95 g/mol. Its IUPAC name is (3S,4S,6aR,6bS,8aR,9R,12aR,14aR,14bR)-4,6a,6b,8a,11,11,14b-heptamethyl-3,9-bis(phenylmethoxy)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-4-ol.
| Compound Name | (3S,4S,6aR,6bS,8aR,9R,12aR,14aR,14bR)-4,6a,6b,8a,11,11,14b-heptamethyl-3,9-bis(phenylmethoxy)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-4-ol |
|---|---|
| PubChem CID | 21136263 |
| Molecular Formula | C43H60O3 |
| Molecular Weight | 624.95 g/mol |
| Exact Mass | 624.45 |
| IUPAC Name | (3S,4S,6aR,6bS,8aR,9R,12aR,14aR,14bR)-4,6a,6b,8a,11,11,14b-heptamethyl-3,9-bis(phenylmethoxy)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-4-ol |
| SMILES | CC1(C)C[C@@H]2C3=CC[C@@H]4[C@@]5(C)CC[C@H](OCc6ccccc6)[C@@](C)(O)C5CC[C@@]4(C)[C@]3(C)CC[C@@]2(C)[C@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C43H60O3/c1-38(2)26-33-32-18-19-34-40(4)22-21-36(45-28-30-14-10-8-11-15-30)43(7,44)35(40)20-23-42(34,6)41(32,5)25-24-39(33,3)37(27-38)46-29-31-16-12-9-13-17-31/h8-18,33-37,44H,19-29H2,1-7H3/t33-,34-,35?,36+,37-,39-,40-,41-,42-,43+/m1/s1 |
| InChIKey | KNZJOSVWEAPTDX-QMAAFBSGSA-N |
| XLogP | 10.31 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.95 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|