C40H60O3 — CID 70800724
2,7,7,10,14,15,18,21,21-nonamethyl-19-phenylmethoxy-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-ene (PubChem CID 70800724) has the molecular formula C40H60O3 and a molecular weight of 588.92 g/mol. Its IUPAC name is 2,7,7,10,14,15,18,21,21-nonamethyl-19-phenylmethoxy-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-ene.
| Compound Name | 2,7,7,10,14,15,18,21,21-nonamethyl-19-phenylmethoxy-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-ene |
|---|---|
| PubChem CID | 70800724 |
| Molecular Formula | C40H60O3 |
| Molecular Weight | 588.92 g/mol |
| Exact Mass | 588.45 |
| IUPAC Name | 2,7,7,10,14,15,18,21,21-nonamethyl-19-phenylmethoxy-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-ene |
| SMILES | CC1(C)CC(OCc2ccccc2)C2(C)CCC3(C)C(=CCC4C5(C)CCC6OC(C)(C)OCC6(C)C5CCC43C)C2C1 |
| InChI | InChI=1S/C40H60O3/c1-34(2)23-29-28-15-16-31-37(6)19-18-32-38(7,26-42-35(3,4)43-32)30(37)17-20-40(31,9)39(28,8)22-21-36(29,5)33(24-34)41-25-27-13-11-10-12-14-27/h10-15,29-33H,16-26H2,1-9H3 |
| InChIKey | OELJRYMSTRMUOU-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.92 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|