C44H66O6 — CID 70800744
methyl 4-[3-[[(2R,5S,10S,14R,15S,18R,19R,23S)-2,7,7,10,14,15,18,21,21-nonamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-en-19-yl]oxy]propoxy]benzoate (PubChem CID 70800744) has the molecular formula C44H66O6 and a molecular weight of 691.01 g/mol. Its IUPAC name is methyl 4-[3-[[(2R,5S,10S,14R,15S,18R,19R,23S)-2,7,7,10,14,15,18,21,21-nonamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-en-19-yl]oxy]propoxy]benzoate.
| Compound Name | methyl 4-[3-[[(2R,5S,10S,14R,15S,18R,19R,23S)-2,7,7,10,14,15,18,21,21-nonamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-en-19-yl]oxy]propoxy]benzoate |
|---|---|
| PubChem CID | 70800744 |
| Molecular Formula | C44H66O6 |
| Molecular Weight | 691.01 g/mol |
| Exact Mass | 690.49 |
| IUPAC Name | methyl 4-[3-[[(2R,5S,10S,14R,15S,18R,19R,23S)-2,7,7,10,14,15,18,21,21-nonamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-en-19-yl]oxy]propoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCCO[C@@H]2CC(C)(C)C[C@H]3C4=CCC5[C@@]6(C)CC[C@@H]7OC(C)(C)OC[C@]7(C)C6CC[C@@]5(C)[C@]4(C)CC[C@@]23C)cc1 |
| InChI | InChI=1S/C44H66O6/c1-38(2)26-32-31-16-17-34-41(6)20-19-35-42(7,28-49-39(3,4)50-35)33(41)18-21-44(34,9)43(31,8)23-22-40(32,5)36(27-38)48-25-11-24-47-30-14-12-29(13-15-30)37(45)46-10/h12-16,32-36H,11,17-28H2,1-10H3/t32-,33?,34?,35-,36+,40+,41-,42+,43+,44+/m0/s1 |
| InChIKey | WCPFKJLYEVMXPI-NJELHEGCSA-N |
| XLogP | 10.19 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.01 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|