C33H52O2 — CID 21136284
(1R,2R,10R,14R,15S,18S,23S)-2,7,7,10,14,15,18,21,21-nonamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacosa-19,24-diene (PubChem CID 21136284) has the molecular formula C33H52O2 and a molecular weight of 480.78 g/mol. Its IUPAC name is (1R,2R,10R,14R,15S,18S,23S)-2,7,7,10,14,15,18,21,21-nonamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacosa-19,24-diene.
| Compound Name | (1R,2R,10R,14R,15S,18S,23S)-2,7,7,10,14,15,18,21,21-nonamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacosa-19,24-diene |
|---|---|
| PubChem CID | 21136284 |
| Molecular Formula | C33H52O2 |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 480.40 |
| IUPAC Name | (1R,2R,10R,14R,15S,18S,23S)-2,7,7,10,14,15,18,21,21-nonamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacosa-19,24-diene |
| SMILES | CC1(C)C=C[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CCC6OC(C)(C)OC[C@@]6(C)C5CC[C@]43C)[C@H]2C1 |
| InChI | InChI=1S/C33H52O2/c1-27(2)16-17-29(5)18-19-32(8)22(23(29)20-27)10-11-25-30(6)14-13-26-31(7,21-34-28(3,4)35-26)24(30)12-15-33(25,32)9/h10,16-17,23-26H,11-15,18-21H2,1-9H3/t23-,24?,25-,26?,29-,30+,31+,32-,33-/m1/s1 |
| InChIKey | QWHUUHNOHLUIBU-DEZPNWJJSA-N |
| XLogP | 8.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|