C33H52O5 — CID 159289213
(2R,4R,5R,10S,14R,15S,18S,21R,22S)-4-hydroxy-2,7,7,10,14,15,21,22-octamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-ene-18-carboxylic acid (PubChem CID 159289213) has the molecular formula C33H52O5 and a molecular weight of 528.77 g/mol. Its IUPAC name is (2R,4R,5R,10S,14R,15S,18S,21R,22S)-4-hydroxy-2,7,7,10,14,15,21,22-octamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-ene-18-carboxylic acid.
| Compound Name | (2R,4R,5R,10S,14R,15S,18S,21R,22S)-4-hydroxy-2,7,7,10,14,15,21,22-octamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-ene-18-carboxylic acid |
|---|---|
| PubChem CID | 159289213 |
| Molecular Formula | C33H52O5 |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | (2R,4R,5R,10S,14R,15S,18S,21R,22S)-4-hydroxy-2,7,7,10,14,15,21,22-octamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-ene-18-carboxylic acid |
| SMILES | C[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)C(=CCC4[C@@]5(C)C[C@@H](O)[C@@H]6OC(C)(C)OC[C@]6(C)C5CC[C@]43C)C2[C@H]1C |
| InChI | InChI=1S/C33H52O5/c1-19-11-14-33(27(35)36)16-15-31(7)21(25(33)20(19)2)9-10-24-29(5)17-22(34)26-30(6,18-37-28(3,4)38-26)23(29)12-13-32(24,31)8/h9,19-20,22-26,34H,10-18H2,1-8H3,(H,35,36)/t19-,20+,22-,23?,24?,25?,26+,29+,30-,31-,32-,33+/m1/s1 |
| InChIKey | JKCISELWSCCJOL-OBUVPRSDSA-N |
| XLogP | 6.83 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|