C32H50O5 — CID 59928370
methyl (2R,10R,14R,15S,18S,21R,22S)-4-hydroxy-2,10,14,15,21,22-hexamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-ene-18-carboxylate (PubChem CID 59928370) has the molecular formula C32H50O5 and a molecular weight of 514.75 g/mol. Its IUPAC name is methyl (2R,10R,14R,15S,18S,21R,22S)-4-hydroxy-2,10,14,15,21,22-hexamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-ene-18-carboxylate.
| Compound Name | methyl (2R,10R,14R,15S,18S,21R,22S)-4-hydroxy-2,10,14,15,21,22-hexamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-ene-18-carboxylate |
|---|---|
| PubChem CID | 59928370 |
| Molecular Formula | C32H50O5 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | methyl (2R,10R,14R,15S,18S,21R,22S)-4-hydroxy-2,10,14,15,21,22-hexamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-ene-18-carboxylate |
| SMILES | COC(=O)[C@]12CC[C@@H](C)[C@H](C)C1C1=CCC3[C@@]4(C)CC(O)C5OCOC[C@@]5(C)C4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H50O5/c1-19-10-13-32(27(34)35-7)15-14-30(5)21(25(32)20(19)2)8-9-24-28(3)16-22(33)26-29(4,17-36-18-37-26)23(28)11-12-31(24,30)6/h8,19-20,22-26,33H,9-18H2,1-7H3/t19-,20+,22?,23?,24?,25?,26?,28+,29+,30-,31-,32+/m1/s1 |
| InChIKey | BRBNILJFTXBIFB-RCNUGVJBSA-N |
| XLogP | 6.14 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|