C31H48O4 — CID 90951714
methyl (1R,2S,5S,8R,9S,15R)-20-(hydroxymethyl)-1,2,8,9,15,20-hexamethyl-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricos-11-ene-5-carboxylate (PubChem CID 90951714) has the molecular formula C31H48O4 and a molecular weight of 484.72 g/mol. Its IUPAC name is methyl (1R,2S,5S,8R,9S,15R)-20-(hydroxymethyl)-1,2,8,9,15,20-hexamethyl-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricos-11-ene-5-carboxylate.
| Compound Name | methyl (1R,2S,5S,8R,9S,15R)-20-(hydroxymethyl)-1,2,8,9,15,20-hexamethyl-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricos-11-ene-5-carboxylate |
|---|---|
| PubChem CID | 90951714 |
| Molecular Formula | C31H48O4 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | methyl (1R,2S,5S,8R,9S,15R)-20-(hydroxymethyl)-1,2,8,9,15,20-hexamethyl-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricos-11-ene-5-carboxylate |
| SMILES | COC(=O)[C@]12CC[C@@H](C)[C@H](C)C1C1=CCC3[C@@]4(C)CC5OC5C(C)(CO)C4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C31H48O4/c1-18-10-13-31(26(33)34-7)15-14-29(5)20(24(31)19(18)2)8-9-23-27(3)16-21-25(35-21)28(4,17-32)22(27)11-12-30(23,29)6/h8,18-19,21-25,32H,9-17H2,1-7H3/t18-,19+,21?,22?,23?,24?,25?,27+,28?,29-,30-,31+/m1/s1 |
| InChIKey | KWXLWMIBDVXTNY-ZUGLKLQRSA-N |
| XLogP | 6.17 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|