C33H52O4 — CID 46937348
(2R,10R,14R,15S,18R)-2,7,7,10,14,18,21,21-octamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-ene-15-carboxylic acid (PubChem CID 46937348) has the molecular formula C33H52O4 and a molecular weight of 512.78 g/mol. Its IUPAC name is (2R,10R,14R,15S,18R)-2,7,7,10,14,18,21,21-octamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-ene-15-carboxylic acid.
| Compound Name | (2R,10R,14R,15S,18R)-2,7,7,10,14,18,21,21-octamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-ene-15-carboxylic acid |
|---|---|
| PubChem CID | 46937348 |
| Molecular Formula | C33H52O4 |
| Molecular Weight | 512.78 g/mol |
| Exact Mass | 512.39 |
| IUPAC Name | (2R,10R,14R,15S,18R)-2,7,7,10,14,18,21,21-octamethyl-6,8-dioxahexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacos-24-ene-15-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C)CC[C@@]3(C(=O)O)C(=CCC4[C@@]5(C)CCC6OC(C)(C)OC[C@@]6(C)C5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C33H52O4/c1-27(2)15-16-29(5)17-18-33(26(34)35)21(22(29)19-27)9-10-24-30(6)13-12-25-31(7,20-36-28(3,4)37-25)23(30)11-14-32(24,33)8/h9,22-25H,10-20H2,1-8H3,(H,34,35)/t22?,23?,24?,25?,29-,30+,31+,32-,33+/m1/s1 |
| InChIKey | UKMCPHKTWARBEJ-PLRUEQLHSA-N |
| XLogP | 8.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.78 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|