C31H46O6 — CID 56952468
(3R,4S,6aR,6bR,8aR,11S,14bR)-3-methoxycarbonyl-4,6a,8a,11,14b-pentamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picene-4,6b-dicarboxylic acid (PubChem CID 56952468) has the molecular formula C31H46O6 and a molecular weight of 514.70 g/mol. Its IUPAC name is (3R,4S,6aR,6bR,8aR,11S,14bR)-3-methoxycarbonyl-4,6a,8a,11,14b-pentamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picene-4,6b-dicarboxylic acid.
| Compound Name | (3R,4S,6aR,6bR,8aR,11S,14bR)-3-methoxycarbonyl-4,6a,8a,11,14b-pentamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picene-4,6b-dicarboxylic acid |
|---|---|
| PubChem CID | 56952468 |
| Molecular Formula | C31H46O6 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | (3R,4S,6aR,6bR,8aR,11S,14bR)-3-methoxycarbonyl-4,6a,8a,11,14b-pentamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picene-4,6b-dicarboxylic acid |
| SMILES | COC(=O)[C@@H]1CC[C@@]2(C)C(CC[C@]3(C)C2CC=C2C4C[C@@H](C)CC[C@]4(C)CC[C@]23C(=O)O)[C@]1(C)C(=O)O |
| InChI | InChI=1S/C31H46O6/c1-18-9-12-27(2)15-16-31(26(35)36)19(21(27)17-18)7-8-22-28(3)13-10-20(24(32)37-6)30(5,25(33)34)23(28)11-14-29(22,31)4/h7,18,20-23H,8-17H2,1-6H3,(H,33,34)(H,35,36)/t18-,20-,21?,22?,23?,27+,28+,29+,30+,31+/m0/s1 |
| InChIKey | NNBNCKZDBLHXCS-WTHUWISNSA-N |
| XLogP | 6.34 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|