C37H56O3 — CID 18362921
4-(hydroxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-9-phenylmethoxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-ol (PubChem CID 18362921) has the molecular formula C37H56O3 and a molecular weight of 548.85 g/mol. Its IUPAC name is 4-(hydroxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-9-phenylmethoxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-ol.
| Compound Name | 4-(hydroxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-9-phenylmethoxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-ol |
|---|---|
| PubChem CID | 18362921 |
| Molecular Formula | C37H56O3 |
| Molecular Weight | 548.85 g/mol |
| Exact Mass | 548.42 |
| IUPAC Name | 4-(hydroxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-9-phenylmethoxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-ol |
| SMILES | CC1(C)CC(OCc2ccccc2)C2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(CO)C5CCC43C)C2C1 |
| InChI | InChI=1S/C37H56O3/c1-32(2)21-27-26-13-14-29-34(4)17-16-30(39)35(5,24-38)28(34)15-18-37(29,7)36(26,6)20-19-33(27,3)31(22-32)40-23-25-11-9-8-10-12-25/h8-13,27-31,38-39H,14-24H2,1-7H3 |
| InChIKey | GJRSUYULQCSLLS-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.85 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|