C39H58O5 — CID 21136253
[(4R,4aR,6aR,6aS,6bR,9R,10S,12aR,14bR)-10-hydroxy-9-(hydroxymethyl)-2,2,4a,6a,6b,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4-yl] 2-phenylmethoxyacetate (PubChem CID 21136253) has the molecular formula C39H58O5 and a molecular weight of 606.89 g/mol. Its IUPAC name is [(4R,4aR,6aR,6aS,6bR,9R,10S,12aR,14bR)-10-hydroxy-9-(hydroxymethyl)-2,2,4a,6a,6b,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4-yl] 2-phenylmethoxyacetate.
| Compound Name | [(4R,4aR,6aR,6aS,6bR,9R,10S,12aR,14bR)-10-hydroxy-9-(hydroxymethyl)-2,2,4a,6a,6b,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4-yl] 2-phenylmethoxyacetate |
|---|---|
| PubChem CID | 21136253 |
| Molecular Formula | C39H58O5 |
| Molecular Weight | 606.89 g/mol |
| Exact Mass | 606.43 |
| IUPAC Name | [(4R,4aR,6aR,6aS,6bR,9R,10S,12aR,14bR)-10-hydroxy-9-(hydroxymethyl)-2,2,4a,6a,6b,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4-yl] 2-phenylmethoxyacetate |
| SMILES | CC1(C)C[C@@H]2C3=CC[C@@H]4[C@@]5(C)CC[C@H](O)[C@@](C)(CO)C5CC[C@@]4(C)[C@]3(C)CC[C@@]2(C)[C@H](OC(=O)COCc2ccccc2)C1 |
| InChI | InChI=1S/C39H58O5/c1-34(2)21-28-27-13-14-30-36(4)17-16-31(41)37(5,25-40)29(36)15-18-39(30,7)38(27,6)20-19-35(28,3)32(22-34)44-33(42)24-43-23-26-11-9-8-10-12-26/h8-13,28-32,40-41H,14-25H2,1-7H3/t28-,29?,30-,31+,32-,35-,36+,37+,38-,39-/m1/s1 |
| InChIKey | YKXAUBZAWJMVAL-DIRHNLSFSA-N |
| XLogP | 7.88 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.89 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|