C45H64O3 — CID 15908349
[(3S,4S,4aR,6aR,6bS,8aR,9R,12aR,14aR,14bR)-4,6a,6b,8a,9,11,11,14b-octamethyl-3,9-bis(phenylmethoxy)-2,3,4a,5,6,7,8,10,12,12a,14,14a-dodecahydro-1H-picen-4-yl]methanol (PubChem CID 15908349) has the molecular formula C45H64O3 and a molecular weight of 653.00 g/mol. Its IUPAC name is [(3S,4S,4aR,6aR,6bS,8aR,9R,12aR,14aR,14bR)-4,6a,6b,8a,9,11,11,14b-octamethyl-3,9-bis(phenylmethoxy)-2,3,4a,5,6,7,8,10,12,12a,14,14a-dodecahydro-1H-picen-4-yl]methanol.
| Compound Name | [(3S,4S,4aR,6aR,6bS,8aR,9R,12aR,14aR,14bR)-4,6a,6b,8a,9,11,11,14b-octamethyl-3,9-bis(phenylmethoxy)-2,3,4a,5,6,7,8,10,12,12a,14,14a-dodecahydro-1H-picen-4-yl]methanol |
|---|---|
| PubChem CID | 15908349 |
| Molecular Formula | C45H64O3 |
| Molecular Weight | 653.00 g/mol |
| Exact Mass | 652.49 |
| IUPAC Name | [(3S,4S,4aR,6aR,6bS,8aR,9R,12aR,14aR,14bR)-4,6a,6b,8a,9,11,11,14b-octamethyl-3,9-bis(phenylmethoxy)-2,3,4a,5,6,7,8,10,12,12a,14,14a-dodecahydro-1H-picen-4-yl]methanol |
| SMILES | CC1(C)C[C@@H]2C3=CC[C@@H]4[C@@]5(C)CC[C@H](OCc6ccccc6)[C@](C)(CO)[C@@H]5CC[C@@]4(C)[C@]3(C)CC[C@@]2(C)[C@](C)(OCc2ccccc2)C1 |
| InChI | InChI=1S/C45H64O3/c1-39(2)27-35-34-19-20-37-40(3)23-22-38(47-28-32-15-11-9-12-16-32)41(4,31-46)36(40)21-24-44(37,7)42(34,5)25-26-43(35,6)45(8,30-39)48-29-33-17-13-10-14-18-33/h9-19,35-38,46H,20-31H2,1-8H3/t35-,36-,37-,38+,40+,41-,42-,43-,44-,45-/m1/s1 |
| InChIKey | CDNBYXZHIHRZHN-HJAMJUNJSA-N |
| XLogP | 10.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.00 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|