C38H58O2 — CID 20696481
(3S,4R,6aR,6bS,8aR,12aS,14aR,14bR)-4-(methoxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-3-phenylmethoxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene (PubChem CID 20696481) has the molecular formula C38H58O2 and a molecular weight of 546.88 g/mol. Its IUPAC name is (3S,4R,6aR,6bS,8aR,12aS,14aR,14bR)-4-(methoxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-3-phenylmethoxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene.
| Compound Name | (3S,4R,6aR,6bS,8aR,12aS,14aR,14bR)-4-(methoxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-3-phenylmethoxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene |
|---|---|
| PubChem CID | 20696481 |
| Molecular Formula | C38H58O2 |
| Molecular Weight | 546.88 g/mol |
| Exact Mass | 546.44 |
| IUPAC Name | (3S,4R,6aR,6bS,8aR,12aS,14aR,14bR)-4-(methoxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-3-phenylmethoxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene |
| SMILES | COC[C@@]1(C)C2CC[C@]3(C)[C@H](CC=C4[C@H]5CC(C)(C)CC[C@]5(C)CC[C@]43C)[C@@]2(C)CC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H58O2/c1-33(2)20-21-34(3)22-23-37(6)28(29(34)24-33)14-15-31-35(4)18-17-32(40-25-27-12-10-9-11-13-27)36(5,26-39-8)30(35)16-19-38(31,37)7/h9-14,29-32H,15-26H2,1-8H3/t29-,30?,31-,32+,34-,35+,36+,37-,38-/m1/s1 |
| InChIKey | RMNMDLPVSIBUDU-WHBJGCONSA-N |
| XLogP | 10.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.88 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|