C34H58O2 — CID 20696500
3-methoxy-4-(methoxymethyl)-4,6a,6b,8a,9,9,11,11,14b-nonamethyl-2,3,4a,5,6,7,8,10,12,12a,14,14a-dodecahydro-1H-picene (PubChem CID 20696500) has the molecular formula C34H58O2 and a molecular weight of 498.84 g/mol. Its IUPAC name is 3-methoxy-4-(methoxymethyl)-4,6a,6b,8a,9,9,11,11,14b-nonamethyl-2,3,4a,5,6,7,8,10,12,12a,14,14a-dodecahydro-1H-picene.
| Compound Name | 3-methoxy-4-(methoxymethyl)-4,6a,6b,8a,9,9,11,11,14b-nonamethyl-2,3,4a,5,6,7,8,10,12,12a,14,14a-dodecahydro-1H-picene |
|---|---|
| PubChem CID | 20696500 |
| Molecular Formula | C34H58O2 |
| Molecular Weight | 498.84 g/mol |
| Exact Mass | 498.44 |
| IUPAC Name | 3-methoxy-4-(methoxymethyl)-4,6a,6b,8a,9,9,11,11,14b-nonamethyl-2,3,4a,5,6,7,8,10,12,12a,14,14a-dodecahydro-1H-picene |
| SMILES | COCC1(C)C(OC)CCC2(C)C1CCC1(C)C2CC=C2C3CC(C)(C)CC(C)(C)C3(C)CCC21C |
| InChI | InChI=1S/C34H58O2/c1-28(2)20-24-23-12-13-26-30(5)16-15-27(36-11)31(6,22-35-10)25(30)14-17-34(26,9)33(23,8)19-18-32(24,7)29(3,4)21-28/h12,24-27H,13-22H2,1-11H3 |
| InChIKey | GNXYQQTWJOXQSU-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.84 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|