C31H52O3 — CID 18362904
4-(methoxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-3,9-diol (PubChem CID 18362904) has the molecular formula C31H52O3 and a molecular weight of 472.75 g/mol. Its IUPAC name is 4-(methoxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-3,9-diol.
| Compound Name | 4-(methoxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-3,9-diol |
|---|---|
| PubChem CID | 18362904 |
| Molecular Formula | C31H52O3 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | 4-(methoxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-3,9-diol |
| SMILES | COCC1(C)C(O)CCC2(C)C1CCC1(C)C2CC=C2C3CC(C)(C)CC(O)C3(C)CCC21C |
| InChI | InChI=1S/C31H52O3/c1-26(2)17-21-20-9-10-23-28(4)13-12-24(32)29(5,19-34-8)22(28)11-14-31(23,7)30(20,6)16-15-27(21,3)25(33)18-26/h9,21-25,32-33H,10-19H2,1-8H3 |
| InChIKey | ZSUBCOMYNQZKKX-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|