C32H55NO — CID 70992041
[(3S,6aR,6bS,8aS,14bS)-8a-(methoxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]methanamine (PubChem CID 70992041) has the molecular formula C32H55NO and a molecular weight of 469.80 g/mol. Its IUPAC name is [(3S,6aR,6bS,8aS,14bS)-8a-(methoxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]methanamine.
| Compound Name | [(3S,6aR,6bS,8aS,14bS)-8a-(methoxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]methanamine |
|---|---|
| PubChem CID | 70992041 |
| Molecular Formula | C32H55NO |
| Molecular Weight | 469.80 g/mol |
| Exact Mass | 469.43 |
| IUPAC Name | [(3S,6aR,6bS,8aS,14bS)-8a-(methoxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]methanamine |
| SMILES | COC[C@]12CCC(C)(C)CC1C1=CCC3[C@@]4(C)CC[C@H](CN)C(C)(C)C4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H55NO/c1-27(2)15-17-32(21-34-8)18-16-30(6)23(24(32)19-27)9-10-26-29(5)13-11-22(20-33)28(3,4)25(29)12-14-31(26,30)7/h9,22,24-26H,10-21,33H2,1-8H3/t22-,24?,25?,26?,29+,30-,31-,32-/m1/s1 |
| InChIKey | AMYAQUWBJQLDCP-CTIQCLFOSA-N |
| XLogP | 8.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.80 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|