C33H52O3Si — CID 138966408
(2R,4aS,5S,7R,9aR)-1,1,4a,7-tetramethyl-2-phenylmethoxy-5-prop-2-enyl-7-(3-trimethylsilyloxypent-4-enyl)-3,4,5,8,9,9a-hexahydro-2H-benzo[7]annulen-6-one (PubChem CID 138966408) has the molecular formula C33H52O3Si and a molecular weight of 524.86 g/mol. Its IUPAC name is (2R,4aS,5S,7R,9aR)-1,1,4a,7-tetramethyl-2-phenylmethoxy-5-prop-2-enyl-7-(3-trimethylsilyloxypent-4-enyl)-3,4,5,8,9,9a-hexahydro-2H-benzo[7]annulen-6-one.
| Compound Name | (2R,4aS,5S,7R,9aR)-1,1,4a,7-tetramethyl-2-phenylmethoxy-5-prop-2-enyl-7-(3-trimethylsilyloxypent-4-enyl)-3,4,5,8,9,9a-hexahydro-2H-benzo[7]annulen-6-one |
|---|---|
| PubChem CID | 138966408 |
| Molecular Formula | C33H52O3Si |
| Molecular Weight | 524.86 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | (2R,4aS,5S,7R,9aR)-1,1,4a,7-tetramethyl-2-phenylmethoxy-5-prop-2-enyl-7-(3-trimethylsilyloxypent-4-enyl)-3,4,5,8,9,9a-hexahydro-2H-benzo[7]annulen-6-one |
| SMILES | C=CC[C@@H]1C(=O)[C@@](C)(CCC(C=C)O[Si](C)(C)C)CC[C@H]2C(C)(C)[C@H](OCc3ccccc3)CC[C@]12C |
| InChI | InChI=1S/C33H52O3Si/c1-10-15-27-30(34)32(5,21-18-26(11-2)36-37(7,8)9)22-19-28-31(3,4)29(20-23-33(27,28)6)35-24-25-16-13-12-14-17-25/h10-14,16-17,26-29H,1-2,15,18-24H2,3-9H3/t26?,27-,28+,29-,32+,33-/m1/s1 |
| InChIKey | KOMZBDZVEGEXDT-SIYGZGMVSA-N |
| XLogP | 8.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.86 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|