C20H25N3O3S — CID 109173399
N-(1,1-dioxothiolan-3-yl)-N-methyl-2-(3-phenylpropylamino)pyridine-4-carboxamide (PubChem CID 109173399) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methyl-2-(3-phenylpropylamino)pyridine-4-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-2-(3-phenylpropylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109173399 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-2-(3-phenylpropylamino)pyridine-4-carboxamide |
| SMILES | CN(C(=O)c1ccnc(NCCCc2ccccc2)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H25N3O3S/c1-23(18-10-13-27(25,26)15-18)20(24)17-9-12-22-19(14-17)21-11-5-8-16-6-3-2-4-7-16/h2-4,6-7,9,12,14,18H,5,8,10-11,13,15H2,1H3,(H,21,22) |
| InChIKey | KZVQQBJBYIUUOI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|