C16H25N3O4S — CID 109167188
N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(3-methoxypropylamino)pyridine-4-carboxamide (PubChem CID 109167188) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(3-methoxypropylamino)pyridine-4-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(3-methoxypropylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109167188 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(3-methoxypropylamino)pyridine-4-carboxamide |
| SMILES | CCN(C(=O)c1ccnc(NCCCOC)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H25N3O4S/c1-3-19(14-6-10-24(21,22)12-14)16(20)13-5-8-18-15(11-13)17-7-4-9-23-2/h5,8,11,14H,3-4,6-7,9-10,12H2,1-2H3,(H,17,18) |
| InChIKey | TVZULFUVVDGVRR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|