C23H24N4O2 — CID 109177121
2-(3-acetamidoanilino)-N-(2,4,6-trimethylphenyl)pyridine-4-carboxamide (PubChem CID 109177121) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-(3-acetamidoanilino)-N-(2,4,6-trimethylphenyl)pyridine-4-carboxamide.
| Compound Name | 2-(3-acetamidoanilino)-N-(2,4,6-trimethylphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109177121 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-(3-acetamidoanilino)-N-(2,4,6-trimethylphenyl)pyridine-4-carboxamide |
| SMILES | CC(=O)Nc1cccc(Nc2cc(C(=O)Nc3c(C)cc(C)cc3C)ccn2)c1 |
| InChI | InChI=1S/C23H24N4O2/c1-14-10-15(2)22(16(3)11-14)27-23(29)18-8-9-24-21(12-18)26-20-7-5-6-19(13-20)25-17(4)28/h5-13H,1-4H3,(H,24,26)(H,25,28)(H,27,29) |
| InChIKey | JUKOCRBHHAEERZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |