C19H13F4N3O — CID 109177254
2-(2-fluoroanilino)-N-[3-(trifluoromethyl)phenyl]pyridine-4-carboxamide (PubChem CID 109177254) has the molecular formula C19H13F4N3O and a molecular weight of 375.33 g/mol. Its IUPAC name is 2-(2-fluoroanilino)-N-[3-(trifluoromethyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-(2-fluoroanilino)-N-[3-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109177254 |
| Molecular Formula | C19H13F4N3O |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-(2-fluoroanilino)-N-[3-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccnc(Nc2ccccc2F)c1 |
| InChI | InChI=1S/C19H13F4N3O/c20-15-6-1-2-7-16(15)26-17-10-12(8-9-24-17)18(27)25-14-5-3-4-13(11-14)19(21,22)23/h1-11H,(H,24,26)(H,25,27) |
| InChIKey | DODLYYVXQYSEIV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |