C23H24N4O2 — CID 109178566
2-(3-acetamidoanilino)-N-ethyl-N-(3-methylphenyl)pyridine-4-carboxamide (PubChem CID 109178566) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-(3-acetamidoanilino)-N-ethyl-N-(3-methylphenyl)pyridine-4-carboxamide.
| Compound Name | 2-(3-acetamidoanilino)-N-ethyl-N-(3-methylphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109178566 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-(3-acetamidoanilino)-N-ethyl-N-(3-methylphenyl)pyridine-4-carboxamide |
| SMILES | CCN(C(=O)c1ccnc(Nc2cccc(NC(C)=O)c2)c1)c1cccc(C)c1 |
| InChI | InChI=1S/C23H24N4O2/c1-4-27(21-10-5-7-16(2)13-21)23(29)18-11-12-24-22(14-18)26-20-9-6-8-19(15-20)25-17(3)28/h5-15H,4H2,1-3H3,(H,24,26)(H,25,28) |
| InChIKey | AYPOUXQAJLPZOM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |