C29H43O5P — CID 10918132
(1R,3S,6S)-6-[(1E,3Z,5E,7E,11E)-13-diethoxyphosphoryl-3,7,12-trimethyltrideca-1,3,5,7,11-pentaen-9-ynyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-ol (PubChem CID 10918132) has the molecular formula C29H43O5P and a molecular weight of 502.63 g/mol. Its IUPAC name is (1R,3S,6S)-6-[(1E,3Z,5E,7E,11E)-13-diethoxyphosphoryl-3,7,12-trimethyltrideca-1,3,5,7,11-pentaen-9-ynyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-ol.
| Compound Name | (1R,3S,6S)-6-[(1E,3Z,5E,7E,11E)-13-diethoxyphosphoryl-3,7,12-trimethyltrideca-1,3,5,7,11-pentaen-9-ynyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-ol |
|---|---|
| PubChem CID | 10918132 |
| Molecular Formula | C29H43O5P |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | (1R,3S,6S)-6-[(1E,3Z,5E,7E,11E)-13-diethoxyphosphoryl-3,7,12-trimethyltrideca-1,3,5,7,11-pentaen-9-ynyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-ol |
| SMILES | CCOP(=O)(C/C(C)=C/C#C/C=C(C)/C=C/C=C(C)\C=C\[C@@]12O[C@]1(C)C[C@@H](O)CC2(C)C)OCC |
| InChI | InChI=1S/C29H43O5P/c1-9-32-35(31,33-10-2)22-25(5)15-12-11-14-23(3)16-13-17-24(4)18-19-29-27(6,7)20-26(30)21-28(29,8)34-29/h13-19,26,30H,9-10,20-22H2,1-8H3/b16-13+,19-18+,23-14+,24-17-,25-15+/t26-,28+,29-/m0/s1 |
| InChIKey | QBETYURIYSHZNA-LAGJXBMLSA-N |
| XLogP | 6.92 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|