C21H28O5 — CID 46242255
methyl (2E,4E,6E)-2-[(E)-2-[(1S,4S,6R)-4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]ethenyl]-6-methyl-8-oxoocta-2,4,6-trienoate (PubChem CID 46242255) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is methyl (2E,4E,6E)-2-[(E)-2-[(1S,4S,6R)-4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]ethenyl]-6-methyl-8-oxoocta-2,4,6-trienoate.
| Compound Name | methyl (2E,4E,6E)-2-[(E)-2-[(1S,4S,6R)-4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]ethenyl]-6-methyl-8-oxoocta-2,4,6-trienoate |
|---|---|
| PubChem CID | 46242255 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | methyl (2E,4E,6E)-2-[(E)-2-[(1S,4S,6R)-4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]ethenyl]-6-methyl-8-oxoocta-2,4,6-trienoate |
| SMILES | COC(=O)C(/C=C/[C@@]12O[C@]1(C)C[C@@H](O)CC2(C)C)=C/C=C/C(C)=C/C=O |
| InChI | InChI=1S/C21H28O5/c1-15(10-12-22)7-6-8-16(18(24)25-5)9-11-21-19(2,3)13-17(23)14-20(21,4)26-21/h6-12,17,23H,13-14H2,1-5H3/b7-6+,11-9+,15-10+,16-8+/t17-,20+,21-/m0/s1 |
| InChIKey | QHEIDVLSZVTLIR-CSIDHOPASA-N |
| XLogP | 3.05 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|