C21H26N4O — CID 109182571
[5-(4-phenylpiperazin-1-yl)-2-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 109182571) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is [5-(4-phenylpiperazin-1-yl)-2-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | [5-(4-phenylpiperazin-1-yl)-2-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 109182571 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | [5-(4-phenylpiperazin-1-yl)-2-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(N2CCN(c3ccccc3)CC2)cn1)N1CCCCC1 |
| InChI | InChI=1S/C21H26N4O/c26-21(25-11-5-2-6-12-25)20-10-9-19(17-22-20)24-15-13-23(14-16-24)18-7-3-1-4-8-18/h1,3-4,7-10,17H,2,5-6,11-16H2 |
| InChIKey | UGQCWNGNUMWBDJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |