C17H17F2N3O — CID 109182712
[5-(2,6-difluoroanilino)-2-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 109182712) has the molecular formula C17H17F2N3O and a molecular weight of 317.34 g/mol. Its IUPAC name is [5-(2,6-difluoroanilino)-2-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | [5-(2,6-difluoroanilino)-2-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 109182712 |
| Molecular Formula | C17H17F2N3O |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | [5-(2,6-difluoroanilino)-2-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(Nc2c(F)cccc2F)cn1)N1CCCCC1 |
| InChI | InChI=1S/C17H17F2N3O/c18-13-5-4-6-14(19)16(13)21-12-7-8-15(20-11-12)17(23)22-9-2-1-3-10-22/h4-8,11,21H,1-3,9-10H2 |
| InChIKey | LSGAGFULOMOOLD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |