C22H20F2N4O — CID 109200601
5-(2,6-difluoroanilino)-N-(4-pyrrolidin-1-ylphenyl)pyridine-2-carboxamide (PubChem CID 109200601) has the molecular formula C22H20F2N4O and a molecular weight of 394.43 g/mol. Its IUPAC name is 5-(2,6-difluoroanilino)-N-(4-pyrrolidin-1-ylphenyl)pyridine-2-carboxamide.
| Compound Name | 5-(2,6-difluoroanilino)-N-(4-pyrrolidin-1-ylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109200601 |
| Molecular Formula | C22H20F2N4O |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 5-(2,6-difluoroanilino)-N-(4-pyrrolidin-1-ylphenyl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)cc1)c1ccc(Nc2c(F)cccc2F)cn1 |
| InChI | InChI=1S/C22H20F2N4O/c23-18-4-3-5-19(24)21(18)26-16-8-11-20(25-14-16)22(29)27-15-6-9-17(10-7-15)28-12-1-2-13-28/h3-11,14,26H,1-2,12-13H2,(H,27,29) |
| InChIKey | GGQQGSBJXLHRBG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|