C18H10F5N3O — CID 109200966
5-(2,6-difluoroanilino)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide (PubChem CID 109200966) has the molecular formula C18H10F5N3O and a molecular weight of 379.29 g/mol. Its IUPAC name is 5-(2,6-difluoroanilino)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide.
| Compound Name | 5-(2,6-difluoroanilino)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109200966 |
| Molecular Formula | C18H10F5N3O |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 5-(2,6-difluoroanilino)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1ccc(Nc2c(F)cccc2F)cn1 |
| InChI | InChI=1S/C18H10F5N3O/c19-10-5-7-13(16(23)15(10)22)26-18(27)14-6-4-9(8-24-14)25-17-11(20)2-1-3-12(17)21/h1-8,25H,(H,26,27) |
| InChIKey | HLHUFUDEKXVHPO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|