C18H17N5O2 — CID 109187203
N-(3-cyanophenyl)-5-(4-formylpiperazin-1-yl)pyridine-2-carboxamide (PubChem CID 109187203) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is N-(3-cyanophenyl)-5-(4-formylpiperazin-1-yl)pyridine-2-carboxamide.
| Compound Name | N-(3-cyanophenyl)-5-(4-formylpiperazin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109187203 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-(3-cyanophenyl)-5-(4-formylpiperazin-1-yl)pyridine-2-carboxamide |
| SMILES | N#Cc1cccc(NC(=O)c2ccc(N3CCN(C=O)CC3)cn2)c1 |
| InChI | InChI=1S/C18H17N5O2/c19-11-14-2-1-3-15(10-14)21-18(25)17-5-4-16(12-20-17)23-8-6-22(13-24)7-9-23/h1-5,10,12-13H,6-9H2,(H,21,25) |
| InChIKey | PLEIMKUTICDABY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|