C17H15F3N4O2 — CID 109187206
5-(4-formylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide (PubChem CID 109187206) has the molecular formula C17H15F3N4O2 and a molecular weight of 364.33 g/mol. Its IUPAC name is 5-(4-formylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide.
| Compound Name | 5-(4-formylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109187206 |
| Molecular Formula | C17H15F3N4O2 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 5-(4-formylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
| SMILES | O=CN1CCN(c2ccc(C(=O)Nc3ccc(F)c(F)c3F)nc2)CC1 |
| InChI | InChI=1S/C17H15F3N4O2/c18-12-2-4-13(16(20)15(12)19)22-17(26)14-3-1-11(9-21-14)24-7-5-23(10-25)6-8-24/h1-4,9-10H,5-8H2,(H,22,26) |
| InChIKey | IGHXYHYSCLFKLN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|