C17H16F2N4O2 — CID 109209004
N-(2,6-difluorophenyl)-4-(4-formylpiperazin-1-yl)pyridine-2-carboxamide (PubChem CID 109209004) has the molecular formula C17H16F2N4O2 and a molecular weight of 346.34 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-4-(4-formylpiperazin-1-yl)pyridine-2-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-4-(4-formylpiperazin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109209004 |
| Molecular Formula | C17H16F2N4O2 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-(2,6-difluorophenyl)-4-(4-formylpiperazin-1-yl)pyridine-2-carboxamide |
| SMILES | O=CN1CCN(c2ccnc(C(=O)Nc3c(F)cccc3F)c2)CC1 |
| InChI | InChI=1S/C17H16F2N4O2/c18-13-2-1-3-14(19)16(13)21-17(25)15-10-12(4-5-20-15)23-8-6-22(11-24)7-9-23/h1-5,10-11H,6-9H2,(H,21,25) |
| InChIKey | GLHTYTBQRANCLP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|