C19H22N4O2 — CID 109208926
N-(3,5-dimethylphenyl)-4-(4-formylpiperazin-1-yl)pyridine-2-carboxamide (PubChem CID 109208926) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-4-(4-formylpiperazin-1-yl)pyridine-2-carboxamide.
| Compound Name | N-(3,5-dimethylphenyl)-4-(4-formylpiperazin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109208926 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-(3,5-dimethylphenyl)-4-(4-formylpiperazin-1-yl)pyridine-2-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2cc(N3CCN(C=O)CC3)ccn2)c1 |
| InChI | InChI=1S/C19H22N4O2/c1-14-9-15(2)11-16(10-14)21-19(25)18-12-17(3-4-20-18)23-7-5-22(13-24)6-8-23/h3-4,9-13H,5-8H2,1-2H3,(H,21,25) |
| InChIKey | GXRNNIIMTGFYAR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|