C18H19F3N4O — CID 109208700
4-(4-ethylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide (PubChem CID 109208700) has the molecular formula C18H19F3N4O and a molecular weight of 364.37 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide.
| Compound Name | 4-(4-ethylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109208700 |
| Molecular Formula | C18H19F3N4O |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
| SMILES | CCN1CCN(c2ccnc(C(=O)Nc3ccc(F)c(F)c3F)c2)CC1 |
| InChI | InChI=1S/C18H19F3N4O/c1-2-24-7-9-25(10-8-24)12-5-6-22-15(11-12)18(26)23-14-4-3-13(19)16(20)17(14)21/h3-6,11H,2,7-10H2,1H3,(H,23,26) |
| InChIKey | RWUSNMIMCFWDLO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|