C18H14N4O2 — CID 109187642
5-(2-cyanoanilino)-N-(furan-2-ylmethyl)pyridine-2-carboxamide (PubChem CID 109187642) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 5-(2-cyanoanilino)-N-(furan-2-ylmethyl)pyridine-2-carboxamide.
| Compound Name | 5-(2-cyanoanilino)-N-(furan-2-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109187642 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 5-(2-cyanoanilino)-N-(furan-2-ylmethyl)pyridine-2-carboxamide |
| SMILES | N#Cc1ccccc1Nc1ccc(C(=O)NCc2ccco2)nc1 |
| InChI | InChI=1S/C18H14N4O2/c19-10-13-4-1-2-6-16(13)22-14-7-8-17(20-11-14)18(23)21-12-15-5-3-9-24-15/h1-9,11,22H,12H2,(H,21,23) |
| InChIKey | NNAISHKRJPKAIR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |